|
CAS#: 96490-18-5 Product: 4-Chloro-2-(2-methyl-2-propanyl)-5-sulfanyl-3(2H)-pyridazinone No suppilers available for the product. |
| Name | 4-Chloro-2-(2-methyl-2-propanyl)-5-sulfanyl-3(2H)-pyridazinone |
|---|---|
| Synonyms | 4-Chloro-2-(1,1-dimethylethyl)-5-mercapto-3(2H)-pyridazinone |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.70 |
| CAS Registry Number | 96490-18-5 |
| SMILES | SC=1/C=N\N(C(=O)C=1Cl)C(C)(C)C |
| InChI | 1S/C8H11ClN2OS/c1-8(2,3)11-7(12)6(9)5(13)4-10-11/h4,13H,1-3H3 |
| InChIKey | GLGQMFICPMIOHO-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.578°C at 760 mmHg (Cal.) |
| Flash point | 106.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-(2-methyl-2-propanyl)-5-sulfanyl-3(2H)-pyridazinone |