|
CAS#: 96563-07-4 Product: 3,9-Dimethylfluorene No suppilers available for the product. |
| Name | 3,9-Dimethylfluorene |
|---|---|
| Synonyms | 9H-Fluorene, 3,9-Dimethyl-; Ccris 4268; 3,9-Dimethylfluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 96563-07-4 |
| SMILES | C1=CC(=CC2=C1C(C3=C2C=CC=C3)C)C |
| InChI | 1S/C15H14/c1-10-7-8-13-11(2)12-5-3-4-6-14(12)15(13)9-10/h3-9,11H,1-2H3 |
| InChIKey | RTYGDUORNCJZHJ-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.886°C at 760 mmHg (Cal.) |
| Flash point | 152.666°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dimethylfluorene |