Online Database of Chemicals from Around the World
|
CAS#: 96568-52-4 Product: 1-(Diphenylmethyl)-3-[3-(trifluoromethyl)phenoxy]azetidine No suppilers available for the product. |
| Name | 1-(Diphenylmethyl)-3-[3-(trifluoromethyl)phenoxy]azetidine |
|---|---|
| Synonyms | 1-(Diphenylmethyl)-3-[3-(trifluoromethyl)phenoxy]-azetidine |
| Molecular Structure | ![CAS#: 96568-52-4, 1-(Diphenylmethyl)-3-[3-(trifluoromethyl)phenoxy]azetidine](/moreStructures/96568-52-4.gif) |
| Molecular Formula | C23H20F3NO |
| Molecular Weight | 383.41 |
| CAS Registry Number | 96568-52-4 |
| SMILES | FC(F)(F)c4cc(OC3CN(C(c1ccccc1)c2ccccc2)C3)ccc4 |
| InChI | 1S/C23H20F3NO/c24-23(25,26)19-12-7-13-20(14-19)28-21-15-27(16-21)22(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-14,21-22H,15-16H2 |
| InChIKey | FZHOEGRWSUOTOO-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.992°C at 760 mmHg (Cal.) |
| Flash point | 218.69°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Diphenylmethyl)-3-[3-(trifluoromethyl)phenoxy]azetidine |