|
CAS#: 96603-22-4 Product: 1-Methyl-3-(2-Nitrophenyl)Triazene N-Oxide No suppilers available for the product. |
| Name | 1-Methyl-3-(2-Nitrophenyl)Triazene N-Oxide |
|---|---|
| Synonyms | N-Methyl-N-(2-Nitrophenyl)Azo-Hydroxylamine; N-Methyl-N-(2-Nitrophenyl)Azohydroxylamine; N-Methyl-N-(2-Nitrophenyl)Diazenyl-Hydroxylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 |
| CAS Registry Number | 96603-22-4 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1)N=NN(O)C |
| InChI | 1S/C7H8N4O3/c1-10(12)9-8-6-4-2-3-5-7(6)11(13)14/h2-5,12H,1H3 |
| InChIKey | XQHZZBLDBWENCR-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.336°C at 760 mmHg (Cal.) |
| Flash point | 168.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-(2-Nitrophenyl)Triazene N-Oxide |