|
CAS#: 96627-10-0 Product: Nudaphantin No suppilers available for the product. |
| Name | Nudaphantin |
|---|---|
| Synonyms | Nudaphantin |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 |
| CAS Registry Number | 96627-10-0 |
| SMILES | C(OC3OC4CC1(OC1C2OC(=O)C(C2C(OC(=O)C(=C)C)CC3=C4)=C)C)C |
| InChI | 1S/C21H26O7/c1-6-24-20-12-7-13(25-20)9-21(5)17(28-21)16-15(11(4)19(23)27-16)14(8-12)26-18(22)10(2)3/h7,13-17,20H,2,4,6,8-9H2,1,3,5H3 |
| InChIKey | ISTMZKUQIYPSSB-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.856°C at 760 mmHg (Cal.) |
| Flash point | 240.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nudaphantin |