|
CAS#: 96725-29-0 Product: 2,2,6-Trimethyl-4,7-dihydro-3H-quinolino[3,4-b]indol-1-one No suppilers available for the product. |
| Name | 2,2,6-Trimethyl-4,7-dihydro-3H-quinolino[3,4-b]indol-1-one |
|---|---|
| Synonyms | 2,2,6-Trimethyl-4,7-Dihydro-3H-Benzo[C]$B-Carbolin-1-One; 1H-Indolo(2,3-C)Quinolin-1-One, 2,3,4,7-Tetrahydro-2,2,6-Trimethyl-; 4'-Oxo-2',2'-Dimethyl-3,4-Tetramethyleneharman |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 |
| CAS Registry Number | 96725-29-0 |
| SMILES | C1=CC=CC2=C1[NH]C3=C(N=C4C(=C23)C(C(CC4)(C)C)=O)C |
| InChI | 1S/C18H18N2O/c1-10-16-14(11-6-4-5-7-12(11)20-16)15-13(19-10)8-9-18(2,3)17(15)21/h4-7,20H,8-9H2,1-3H3 |
| InChIKey | LPEPDWACHDVAIC-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.644°C at 760 mmHg (Cal.) |
| Flash point | 248.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,6-Trimethyl-4,7-dihydro-3H-quinolino[3,4-b]indol-1-one |