|
CAS#: 96803-92-8 Product: 6-Hydroxybenzo[b]Thiophene-2-Sulfonamide Acetate Ester No suppilers available for the product. |
| Name | 6-Hydroxybenzo[b]Thiophene-2-Sulfonamide Acetate Ester |
|---|---|
| Synonyms | (2-Sulfamoylbenzothiophen-6-Yl) Acetate; Acetic Acid (2-Sulfamoyl-6-Benzothiophenyl) Ester; Acetic Acid (2-Sulfamoylbenzothiophen-6-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4S2 |
| Molecular Weight | 271.31 |
| CAS Registry Number | 96803-92-8 |
| SMILES | C1=C(SC2=CC(=CC=C12)OC(=O)C)[S](=O)(=O)N |
| InChI | 1S/C10H9NO4S2/c1-6(12)15-8-3-2-7-4-10(17(11,13)14)16-9(7)5-8/h2-5H,1H3,(H2,11,13,14) |
| InChIKey | XOFVNNKNKJTRRS-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.967°C at 760 mmHg (Cal.) |
| Flash point | 253.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxybenzo[b]Thiophene-2-Sulfonamide Acetate Ester |