|
CAS#: 96846-66-1 Product: 2-Methyl-6-Methylene-2-Octyl Propionate No suppilers available for the product. |
| Name | 2-Methyl-6-Methylene-2-Octyl Propionate |
|---|---|
| Synonyms | 2,4-Dimethyl-8-Methylene-Decanoate; 2,4-Dimethyl-8-Methylenedecanoate; 8-Ethyl-2,4-Dimethyl-Non-8-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H23O2 |
| Molecular Weight | 211.32 |
| CAS Registry Number | 96846-66-1 |
| EINECS | 306-302-1 |
| SMILES | C(C(CC(C)C([O-])=O)C)CCC(CC)=C |
| InChI | 1S/C13H24O2/c1-5-10(2)7-6-8-11(3)9-12(4)13(14)15/h11-12H,2,5-9H2,1,3-4H3,(H,14,15)/p-1 |
| InChIKey | UYURTTFESNHISN-UHFFFAOYSA-M |
| Boiling point | 315.089°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-6-Methylene-2-Octyl Propionate |