|
CAS#: 97043-74-8 Product: N,N-Dibutyl-2-Chloro-4-Nitroaniline No suppilers available for the product. |
| Name | N,N-Dibutyl-2-Chloro-4-Nitroaniline |
|---|---|
| Synonyms | N,N-Dibutyl-2-Chloro-4-Nitro-Aniline; Dibutyl-(2-Chloro-4-Nitro-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 |
| CAS Registry Number | 97043-74-8 |
| EINECS | 306-324-1 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1Cl)N(CCCC)CCCC |
| InChI | 1S/C14H21ClN2O2/c1-3-5-9-16(10-6-4-2)14-8-7-12(17(18)19)11-13(14)15/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | QMRCMQGZXWYYIP-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.193°C at 760 mmHg (Cal.) |
| Flash point | 186.154°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dibutyl-2-Chloro-4-Nitroaniline |