|
CAS#: 97143-16-3 Product: Patulolide A No suppilers available for the product. |
| Name | Patulolide A |
|---|---|
| Synonyms | (3E,12R)-12-Methyl-1-Oxacyclododec-3-Ene-2,5-Quinone; Oxacyclododec-3-Ene-2,5-Dione, 12-Methyl-, (R-(E))-; Patulolide A |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 |
| CAS Registry Number | 97143-16-3 (103729-43-7) |
| SMILES | [C@@H]1(OC(/C=C/C(=O)CCCCCC1)=O)C |
| InChI | 1S/C12H18O3/c1-10-6-4-2-3-5-7-11(13)8-9-12(14)15-10/h8-10H,2-7H2,1H3/b9-8+/t10-/m1/s1 |
| InChIKey | XETYGXGLGYXEIT-AAXQSMANSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.339°C at 760 mmHg (Cal.) |
| Flash point | 161.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Patulolide A |