|
CAS#: 97181-56-1 Product: 2,2-Dimethyl-N-Benzylmalonamide No suppilers available for the product. |
| Name | 2,2-Dimethyl-N-Benzylmalonamide |
|---|---|
| Synonyms | N'-(Benzyl)-2,2-Dimethyl-Malonamide; 2,2-Dimethyl-N-Benzylmalonamide; 2,2-Dmnbm |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 97181-56-1 |
| SMILES | C1=C(CNC(C(C(=O)N)(C)C)=O)C=CC=C1 |
| InChI | 1S/C12H16N2O2/c1-12(2,10(13)15)11(16)14-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | IVDIXZVQCWZQOL-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.8°C at 760 mmHg (Cal.) |
| Flash point | 246.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-N-Benzylmalonamide |