|
CAS#: 97233-27-7 Product: Diethylammonium (R)-2-(4-Chloro-2-Methylphenoxy)Propionate No suppilers available for the product. |
| Name | Diethylammonium (R)-2-(4-Chloro-2-Methylphenoxy)Propionate |
|---|---|
| Synonyms | diethylammonium (R)-2-(4-chloro-2-methylphenoxy)propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.78 |
| CAS Registry Number | 97233-27-7 |
| EINECS | 306-418-2 |
| SMILES | Clc1cc(C)c(O[C@H](C)C([O-])=O)cc1.CC[NH2+]CC |
| InChI | 1S/C10H11ClO3.C4H11N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-5-4-2/h3-5,7H,1-2H3,(H,12,13);5H,3-4H2,1-2H3/t7-;/m1./s1 |
| InChIKey | YWWMOSBBXLVHSK-OGFXRTJISA-N |
| Boiling point | 398.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylammonium (R)-2-(4-Chloro-2-Methylphenoxy)Propionate |