CAS#: 97359-75-6 Product: Irisone B No suppilers available for the product. |
Name | Irisone B |
---|---|
Synonyms | 9-Hydroxy-7-(2-Hydroxyphenyl)-8-Pyrano[2,3-F][1,3]Benzodioxolone; 2',5-Dihydroxy-6,7-Methylenedioxyisoflavone; Nsc621635 |
Molecular Structure | ![]() |
Molecular Formula | C16H10O6 |
Molecular Weight | 298.25 |
CAS Registry Number | 97359-75-6 |
SMILES | C1=C3C(=C(C2=C1OCO2)O)C(C(=CO3)C4=C(O)C=CC=C4)=O |
InChI | 1S/C16H10O6/c17-10-4-2-1-3-8(10)9-6-20-11-5-12-16(22-7-21-12)15(19)13(11)14(9)18/h1-6,17,19H,7H2 |
InChIKey | ITRQVDOUFMSYII-UHFFFAOYSA-N |
Density | 1.592g/cm3 (Cal.) |
---|---|
Boiling point | 541.448°C at 760 mmHg (Cal.) |
Flash point | 208.946°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Irisone B |