|
CAS#: 97373-39-2 Product: Methyl (5R)-5-methyl-L-prolinate No suppilers available for the product. |
| Name | Methyl (5R)-5-methyl-L-prolinate |
|---|---|
| Synonyms | (2S,5R)-methyl 5-methylpyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.18 |
| CAS Registry Number | 97373-39-2 |
| SMILES | C[C@@H]1CC[C@H](N1)C(=O)OC |
| InChI | 1S/C7H13NO2/c1-5-3-4-6(8-5)7(9)10-2/h5-6,8H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | FZBQCOBVXDOWIT-RITPCOANSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 182.495°C at 760 mmHg (Cal.) |
| Flash point | 64.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (5R)-5-methyl-L-prolinate |