|
CAS#: 97402-97-6 Product: beta-Ethylideneaspartate No suppilers available for the product. |
| Name | beta-Ethylideneaspartate |
|---|---|
| Synonyms | (2S,3Z)-2-Amino-3-Ethylidene-Butanedioic Acid; (2S,3Z)-2-Amino-3-Ethylidene-Succinic Acid; Beta-Ethylidene-Dl-Aspartate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 |
| CAS Registry Number | 97402-97-6 |
| SMILES | [C@H](N)(\C(C(=O)O)=C\C)C(=O)O |
| InChI | 1S/C6H9NO4/c1-2-3(5(8)9)4(7)6(10)11/h2,4H,7H2,1H3,(H,8,9)(H,10,11)/b3-2-/t4-/m0/s1 |
| InChIKey | OHNZEFGZTXQOCT-SWOZAWMQSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.585°C at 760 mmHg (Cal.) |
| Flash point | 217.234°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Ethylideneaspartate |