|
CAS#: 97404-13-2 Product: 1-(2-aminoethylamino)anthracene-9,10-dione hydrochloride No suppilers available for the product. |
| Name | 1-(2-aminoethylamino)anthracene-9,10-dione hydrochloride |
|---|---|
| Synonyms | 1-[(2-aminoethyl)amino]anthraquinone, monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 |
| CAS Registry Number | 97404-13-2 |
| EINECS | 306-777-5 |
| SMILES | Cl.O=C3c1ccccc1C(=O)c2c3cccc2NCCN |
| InChI | 1S/C16H14N2O2.ClH/c17-8-9-18-13-7-3-6-12-14(13)16(20)11-5-2-1-4-10(11)15(12)19;/h1-7,18H,8-9,17H2;1H |
| InChIKey | WYTHYWAAQAHLGD-UHFFFAOYSA-N |
| Boiling point | 535.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 277.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-aminoethylamino)anthracene-9,10-dione hydrochloride |