|
CAS#: 97415-40-2 Product: Hypoestestatin 2 No suppilers available for the product. |
| Name | Hypoestestatin 2 |
|---|---|
| Synonyms | Hypoestestatin 2 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.45 |
| CAS Registry Number | 97415-40-2 |
| SMILES | [C@H]12N(CCC1)CC4=C([C@H]2O)C3=C(C=C(C(=C3)OC)OC)C5=C4C=CC(=C5)OC |
| InChI | 1S/C23H25NO4/c1-26-13-6-7-14-15(9-13)16-10-20(27-2)21(28-3)11-17(16)22-18(14)12-24-8-4-5-19(24)23(22)25/h6-7,9-11,19,23,25H,4-5,8,12H2,1-3H3/t19-,23-/m0/s1 |
| InChIKey | VEPWWLXWVFFRLY-CVDCTZTESA-N |
| Density | 1.316g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.472°C at 760 mmHg (Cal.) |
| Flash point | 309.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hypoestestatin 2 |