|
CAS#: 97465-32-2 Product: Methyl (5R)-5-ethyl-L-prolinate No suppilers available for the product. |
| Name | Methyl (5R)-5-ethyl-L-prolinate |
|---|---|
| Synonyms | (2S,5R)-methyl 5-ethylpyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 97465-32-2 |
| SMILES | CC[C@@H]1CC[C@H](N1)C(=O)OC |
| InChI | 1S/C8H15NO2/c1-3-6-4-5-7(9-6)8(10)11-2/h6-7,9H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | JEUBHRNABRBLNZ-RQJHMYQMSA-N |
| Density | 0.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 203.98°C at 760 mmHg (Cal.) |
| Flash point | 77.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (5R)-5-ethyl-L-prolinate |