|
CAS#: 97466-90-5 Product: Quinelorane No suppilers available for the product. |
| Name | Quinelorane |
|---|---|
| Synonyms | [(5Ar,9Ar)-6-Propyl-5A,7,8,9,9A,10-Hexahydro-5H-Pyrido[2,3-G]Quinazolin-2-Yl]Amine; Pyrido(2,3-G)Quinazolin-2-Amine, 5,5A,6,7,8,9,9A,10-Octahydro-6-Propyl-, (5Ar-Trans)-; Quinelorane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.35 |
| CAS Registry Number | 97466-90-5 |
| SMILES | [C@H]23[C@@H](CC1=NC(=NC=C1C2)N)CCCN3CCC |
| InChI | 1S/C14H22N4/c1-2-5-18-6-3-4-10-7-12-11(8-13(10)18)9-16-14(15)17-12/h9-10,13H,2-8H2,1H3,(H2,15,16,17)/t10-,13-/m1/s1 |
| InChIKey | TUFADSGTJUOBEH-ZWNOBZJWSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.452°C at 760 mmHg (Cal.) |
| Flash point | 218.968°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Quinelorane |