|
CAS#: 97501-15-0 Product: 2-(Fluoromethyl)Dehydroornithine Ethyl Ester No suppilers available for the product. |
| Name | 2-(Fluoromethyl)Dehydroornithine Ethyl Ester |
|---|---|
| Synonyms | (E)-2,5-Diamino-2-(Fluoromethyl)Pent-3-Enoic Acid Ethyl Ester; 2-(Fluoromethyl)Dehydroornithine Ethyl Ester; 3-Pentenoic Acid, 2,5-Diamino-2-(Fluoromethyl)-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15FN2O2 |
| Molecular Weight | 190.22 |
| CAS Registry Number | 97501-15-0 |
| SMILES | C(F)C(N)(C(OCC)=O)\C=C\CN |
| InChI | 1S/C8H15FN2O2/c1-2-13-7(12)8(11,6-9)4-3-5-10/h3-4H,2,5-6,10-11H2,1H3/b4-3+ |
| InChIKey | RQVGWIPBGFYUQU-ONEGZZNKSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.825°C at 760 mmHg (Cal.) |
| Flash point | 130.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Fluoromethyl)Dehydroornithine Ethyl Ester |