|
CAS#: 97552-62-0 Product: Cyclohexyl(2,2-Dimethoxyethyl)Ammonium Chloride No suppilers available for the product. |
| Name | Cyclohexyl(2,2-Dimethoxyethyl)Ammonium Chloride |
|---|---|
| Synonyms | Cyclohexyl-(2,2-Dimethoxyethyl)Ammonium Chloride; Cyclohexyl(2,2-Dimethoxyethyl)Ammonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22ClNO2 |
| Molecular Weight | 223.74 |
| CAS Registry Number | 97552-62-0 |
| EINECS | 307-115-8 |
| SMILES | C([NH2+]C1CCCCC1)C(OC)OC.[Cl-] |
| InChI | 1S/C10H21NO2.ClH/c1-12-10(13-2)8-11-9-6-4-3-5-7-9;/h9-11H,3-8H2,1-2H3;1H |
| InChIKey | VAPIPGSCONDQCL-UHFFFAOYSA-N |
| Boiling point | 243.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 100.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclohexyl(2,2-Dimethoxyethyl)Ammonium Chloride |