|
CAS#: 97564-42-6 Product: 4-Propylphenyl (1r,1's,4r,4'S)-4'-propyl-1,1'-bi(cyclohexyl)-4-carboxylate No suppilers available for the product. |
| Name | 4-Propylphenyl (1r,1's,4r,4'S)-4'-propyl-1,1'-bi(cyclohexyl)-4-carboxylate |
|---|---|
| Synonyms | 4-Propylp |
| Molecular Structure | ![]() |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.57 |
| CAS Registry Number | 97564-42-6 |
| SMILES | CCCc1ccc(cc1)OC(=O)[C@H]2CC[C@@H](CC2)C3CC[C@@H](CC3)CCC |
| InChI | 1S/C25H38O2/c1-3-5-19-7-11-21(12-8-19)22-13-15-23(16-14-22)25(26)27-24-17-9-20(6-4-2)10-18-24/h9-10,17-19,21-23H,3-8,11-16H2,1-2H3/t19-,21?,22-,23- |
| InChIKey | JHDGZPSFHYZDNF-IJLMCXJXSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.862°C at 760 mmHg (Cal.) |
| Flash point | 148.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Propylphenyl (1r,1's,4r,4'S)-4'-propyl-1,1'-bi(cyclohexyl)-4-carboxylate |