|
CAS#: 97635-45-5 Product: 2-Ethylhexyl 3,6-Dichloropyridine-2-Carboxylate No suppilers available for the product. |
| Name | 2-Ethylhexyl 3,6-Dichloropyridine-2-Carboxylate |
|---|---|
| Synonyms | 3,6-Dichloro-2-Pyridinecarboxylic Acid 2-Ethylhexyl Ester; 3,6-Dichloropicolinic Acid 2-Ethylhexyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 |
| CAS Registry Number | 97635-45-5 |
| EINECS | 307-405-4 |
| SMILES | C1=C(C(=NC(=C1)Cl)C(=O)OCC(CCCC)CC)Cl |
| InChI | 1S/C14H19Cl2NO2/c1-3-5-6-10(4-2)9-19-14(18)13-11(15)7-8-12(16)17-13/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | BOOFNDJFNWCPQD-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylhexyl 3,6-Dichloropyridine-2-Carboxylate |