|
CAS#: 97752-32-4 Product: 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzotriazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate No suppilers available for the product. |
| Name | 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzotriazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate |
|---|---|
| Synonyms | 6-chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24ClN7O2 |
| Molecular Weight | 429.90 |
| CAS Registry Number | 97752-32-4 |
| EINECS | 307-795-6 |
| SMILES | [O-]C=O.CCN(CCC#N)c1ccc(cc1)N=Nc3cc(Cl)cc2[NH+](C)NN(C)c23 |
| InChI | 1S/C19H22ClN7.CH2O2/c1-4-27(11-5-10-21)16-8-6-15(7-9-16)22-23-17-12-14(20)13-18-19(17)26(3)24-25(18)2;2-1-3/h6-9,12-13,24H,4-5,11H2,1-3H3;1H,(H,2,3) |
| InChIKey | OXDQSZNXYBCFNZ-UHFFFAOYSA-N |
| Boiling point | 669.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 358.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[[4-[(6-chloro-1,3-dimethyl-2H-benzotriazol-1-ium-4-yl)azo]phenyl]-ethyl-amino]propanenitrile formate |