Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-[4-(4-Piperidinyloxy)phenyl]ethanone |
|---|---|
| Molecular Structure | ![CAS#: 97840-07-8, 1-[4-(4-Piperidinyloxy)phenyl]ethanone](/moreStructures/97840-07-8.gif) |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 97840-07-8 |
| SMILES | CC(=O)c1ccc(cc1)OC2CCNCC2 |
| InChI | 1S/C13H17NO2/c1-10(15)11-2-4-12(5-3-11)16-13-6-8-14-9-7-13/h2-5,13-14H,6-9H2,1H3 |
| InChIKey | VIQQHIFMUUEXLB-UHFFFAOYSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.266°C at 760 mmHg (Cal.) |
| Flash point | 178.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(4-Piperidinyloxy)phenyl]ethanone |