|
CAS#: 97874-33-4 Product: 3-((Methyl(2-Phenylethyl)Amino)Methyl)-Benzo[c]Thiophen-1(3H)-One Ethanedioate No suppilers available for the product. |
| Name | 3-((Methyl(2-Phenylethyl)Amino)Methyl)-Benzo[c]Thiophen-1(3H)-One Ethanedioate |
|---|---|
| Synonyms | 3-[(Methyl-(2-Phenylethyl)Amino)Methyl]-3H-Isobenzothiophen-1-One; Oxalic Acid; Ethanedioic Acid; 3-[(Methyl-(2-Phenylethyl)Amino)Methyl]-3H-2-Benzothiophen-1-One; 3-((Methyl(2-Phenylethyl)Amino)Methyl)Benzo(C)Thiophen-1(3H)-One Ethanedioate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.45 |
| CAS Registry Number | 97874-33-4 |
| SMILES | C1=C2C(=CC=C1)C(SC2CN(CCC3=CC=CC=C3)C)=O.O=C(O)C(=O)O |
| InChI | 1S/C18H19NOS.C2H2O4/c1-19(12-11-14-7-3-2-4-8-14)13-17-15-9-5-6-10-16(15)18(20)21-17;3-1(4)2(5)6/h2-10,17H,11-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KDWHHALWBMMKJO-UHFFFAOYSA-N |
| Boiling point | 422.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 209.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-((Methyl(2-Phenylethyl)Amino)Methyl)-Benzo[c]Thiophen-1(3H)-One Ethanedioate |