|
CAS#: 97889-93-5 Product: 4-(1-Methyl-1-Phenylethyl)Phenyl Hydrogen Carbonate No suppilers available for the product. |
| Name | 4-(1-Methyl-1-Phenylethyl)Phenyl Hydrogen Carbonate |
|---|---|
| Synonyms | [4-(1-Methyl-1-Phenyl-Ethyl)Phenyl] Hydrogen Carbonate; [4-(1-Methyl-1-Phenylethyl)Phenyl] Hydrogen Carbonate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 97889-93-5 |
| EINECS | 308-172-1 |
| SMILES | C2=C(C(C1=CC=CC=C1)(C)C)C=CC(=C2)OC(=O)O |
| InChI | 1S/C16H16O3/c1-16(2,12-6-4-3-5-7-12)13-8-10-14(11-9-13)19-15(17)18/h3-11H,1-2H3,(H,17,18) |
| InChIKey | UGKSTGOPBDJAGS-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.562°C at 760 mmHg (Cal.) |
| Flash point | 142.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Methyl-1-Phenylethyl)Phenyl Hydrogen Carbonate |