|
CAS#: 97890-17-0 Product: Bis(2,3-Epoxypropyl) 3,4,5,6-Tetrachlorophthalate No suppilers available for the product. |
| Name | Bis(2,3-Epoxypropyl) 3,4,5,6-Tetrachlorophthalate |
|---|---|
| Synonyms | 3,4,5,6-Tetrachlorobenzene-1,2-Dicarboxylic Acid Bis(2-Oxiranylmethyl) Ester; 3,4,5,6-Tetrachlorobenzene-1,2-Dicarboxylic Acid Diglycidyl Ester; Bis(2,3-Epoxypropyl) 3,4,5,6-Tetrachlorophthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10Cl4O6 |
| Molecular Weight | 416.04 |
| CAS Registry Number | 97890-17-0 |
| EINECS | 308-197-8 |
| SMILES | C(C1OC1)OC(C2=C(C(=C(C(=C2C(OCC3OC3)=O)Cl)Cl)Cl)Cl)=O |
| InChI | 1S/C14H10Cl4O6/c15-9-7(13(19)23-3-5-1-21-5)8(10(16)12(18)11(9)17)14(20)24-4-6-2-22-6/h5-6H,1-4H2 |
| InChIKey | QSDWFFRGNSHCEP-UHFFFAOYSA-N |
| Density | 1.64g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.33°C at 760 mmHg (Cal.) |
| Flash point | 198.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,3-Epoxypropyl) 3,4,5,6-Tetrachlorophthalate |