Online Database of Chemicals from Around the World
|
CAS#: 97937-19-4 Product: 4,5-Dimethylthiazole-N-Oxide-S-Oxide No suppilers available for the product. |
| Name | 4,5-Dimethylthiazole-N-Oxide-S-Oxide |
|---|---|
| Synonyms | 4,5-Dimethyl-3-Oxido-Thiazol-3-Ium 1-Oxide; 4,5-Dimethyl-3-Oxidothiazol-3-Ium 1-Oxide; 4,5-Dimethylthiazole-N-Oxide-S-Oxide |
| Molecular Structure |  |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 |
| CAS Registry Number | 97937-19-4 |
| SMILES | [S]1(=O)C(=C([N+](=C1)[O-])C)C |
| InChI | 1S/C5H7NO2S/c1-4-5(2)9(8)3-6(4)7/h3H,1-2H3 |
| InChIKey | RALPCBXACRAYDQ-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.426°C at 760 mmHg (Cal.) |
| Flash point | 154.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethylthiazole-N-Oxide-S-Oxide |