|
CAS#: 98015-52-2 Product: 2-Methyl-2-propanyl 1,2,2,2-tetrachloroethyl carbonate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 1,2,2,2-tetrachloroethyl carbonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Cl4O3 |
| Molecular Weight | 283.96 |
| CAS Registry Number | 98015-52-2 |
| SMILES | O=C(OC(Cl)C(Cl)(Cl)Cl)OC(C)(C)C |
| InChI | 1S/C7H10Cl4O3/c1-6(2,3)14-5(12)13-4(8)7(9,10)11/h4H,1-3H3 |
| InChIKey | WDXXKETZCOFWQL-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.354°C at 760 mmHg (Cal.) |
| Flash point | 97.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 1,2,2,2-tetrachloroethyl carbonate |