|
CAS#: 98033-20-6 Product: 2'-O-Anthraniloyl adenosine monophosphate No suppilers available for the product. |
| Name | 2'-O-Anthraniloyl adenosine monophosphate |
|---|---|
| Synonyms | [(3R,4R,5R)-2-(6-Aminopurin-9-Yl)-4-Hydroxy-5-(Phosphonooxymethyl)Tetrahydrofuran-3-Yl] 2-Aminobenzoate; 2-Aminobenzoic Acid [(3R,4R,5R)-2-(6-Amino-9-Purinyl)-4-Hydroxy-5-(Phosphonooxymethyl)-3-Tetrahydrofuranyl] Ester; 2-Aminobenzoic Acid [(3R,4R,5R)-2-(6- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19N6O8P |
| Molecular Weight | 466.35 |
| CAS Registry Number | 98033-20-6 |
| SMILES | [N]4(C1O[C@@H]([C@@H](O)[C@H]1OC(=O)C2=CC=CC=C2N)CO[P](=O)(O)O)C3=NC=NC(=C3N=C4)N |
| InChI | 1S/C17H19N6O8P/c18-9-4-2-1-3-8(9)17(25)31-13-12(24)10(5-29-32(26,27)28)30-16(13)23-7-22-11-14(19)20-6-21-15(11)23/h1-4,6-7,10,12-13,16,24H,5,18H2,(H2,19,20,21)(H2,26,27,28)/t10-,12-,13-,16?/m1/s1 |
| InChIKey | SVECXPKOHPSQAS-AARXTDBFSA-N |
| Density | 1.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 857.28°C at 760 mmHg (Cal.) |
| Flash point | 472.266°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-O-Anthraniloyl adenosine monophosphate |