|
CAS#: 98072-08-3 Product: Triethyl[2-[(1-Oxooctyl)Oxy]Ethyl]Ammonium Ethyl Sulphate No suppilers available for the product. |
| Name | Triethyl[2-[(1-Oxooctyl)Oxy]Ethyl]Ammonium Ethyl Sulphate |
|---|---|
| Synonyms | Ethyl Sulfate; Triethyl-(2-Octanoyloxyethyl)Ammonium; Ethyl Sulfate; Triethyl-[2-(1-Oxooctoxy)Ethyl]Ammonium; 2-Caprylyloxyethyl-Triethyl-Ammonium; Ethyl Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H39NO6S |
| Molecular Weight | 397.57 |
| CAS Registry Number | 98072-08-3 |
| EINECS | 308-458-6 |
| SMILES | C(O[S]([O-])(=O)=O)C.C([N+](CC)(CC)CC)COC(=O)CCCCCCC |
| InChI | 1S/C16H34NO2.C2H6O4S/c1-5-9-10-11-12-13-16(18)19-15-14-17(6-2,7-3)8-4;1-2-6-7(3,4)5/h5-15H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | UVMDHJDDPXKIIO-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Triethyl[2-[(1-Oxooctyl)Oxy]Ethyl]Ammonium Ethyl Sulphate |