|
CAS#: 98072-25-4 Product: bis(2-hydroxyethyl)ammonium sulfite No suppilers available for the product. |
| Name | bis(2-hydroxyethyl)ammonium sulfite |
|---|---|
| Synonyms | bis[bis(2-hydroxyethyl)ammonium] sulphite |
| Molecular Structure | ![]() |
| Molecular Formula | C8H24N2O7S |
| Molecular Weight | 292.35 |
| CAS Registry Number | 98072-25-4 |
| EINECS | 308-475-9 |
| SMILES | OCC[NH2+]CCO.[O-]S([O-])=O.OCC[NH2+]CCO |
| InChI | 1S/2C4H11NO2.H2O3S/c2*6-3-1-5-2-4-7;1-4(2)3/h2*5-7H,1-4H2;(H2,1,2,3) |
| InChIKey | XMAXOLKEZRLIOL-UHFFFAOYSA-N |
| Boiling point | 655.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 350.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for bis(2-hydroxyethyl)ammonium sulfite |