|
CAS#: 981-87-3 Product: 2,4,6-Trichloro-1.3.5-triphenylborazine No suppilers available for the product. |
| Name | 2,4,6-Trichloro-1.3.5-triphenylborazine |
|---|---|
| Synonyms | 2,4,6-Trichloro-1,3,5-Triphenylborazine; 4-12-00-01098 (Beilstein Handbook Reference); Borazine, 2,4,6-Trichloro-1,3,5-Triphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15B3Cl3N3 |
| Molecular Weight | 412.13 |
| CAS Registry Number | 981-87-3 |
| SMILES | C1=CC=CC=C1B3N(B(C2=CC=CC=C2)N(B(N3Cl)C4=CC=CC=C4)Cl)Cl |
| InChI | 1S/C18H15B3Cl3N3/c22-25-19(16-10-4-1-5-11-16)26(23)21(18-14-8-3-9-15-18)27(24)20(25)17-12-6-2-7-13-17/h1-15H |
| InChIKey | NVBQPAAXHSMATH-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.538°C at 760 mmHg (Cal.) |
| Flash point | 228.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trichloro-1.3.5-triphenylborazine |