|
CAS#: 98102-30-8 Product: 4-Fluoroandrostenedione No suppilers available for the product. |
| Name | 4-Fluoroandrostenedione |
|---|---|
| Synonyms | (8R,9S,10R,13S,14S)-4-Fluoro-10,13-Dimethyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthrene-3,17-Quinone; 4-Fad; 4-Fluoroandrost-4-Ene-3,17-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.40 |
| CAS Registry Number | 98102-30-8 |
| SMILES | [C@@H]23CCC1=C(C(CC[C@@]1([C@H]2CC[C@]4([C@H]3CCC4=O)C)C)=O)F |
| InChI | 1S/C19H25FO2/c1-18-10-8-15(21)17(20)14(18)4-3-11-12-5-6-16(22)19(12,2)9-7-13(11)18/h11-13H,3-10H2,1-2H3/t11-,12-,13-,18+,19-/m0/s1 |
| InChIKey | QBRBEAIYDMHSJE-KZQROQTASA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.239°C at 760 mmHg (Cal.) |
| Flash point | 161.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoroandrostenedione |