|
CAS#: 98166-25-7 Product: 2,3,4,5-Tetrahydropyrano[3,2-b]indole No suppilers available for the product. |
| Name | 2,3,4,5-Tetrahydropyrano[3,2-b]indole |
|---|---|
| Synonyms | 1,2,3,4-Tetrahydro-4-oxacarbazole |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| CAS Registry Number | 98166-25-7 |
| SMILES | c1ccc2c(c1)c3c([nH]2)CCCO3 |
| InChI | 1S/C11H11NO/c1-2-5-9-8(4-1)11-10(12-9)6-3-7-13-11/h1-2,4-5,12H,3,6-7H2 |
| InChIKey | LIJWFPFREDVZFQ-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.141°C at 760 mmHg (Cal.) |
| Flash point | 127.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrahydropyrano[3,2-b]indole |