|
CAS#: 98316-95-1 Product: 2,2-Dimethylpenam Sulfone No suppilers available for the product. |
| Name | 2,2-Dimethylpenam Sulfone |
|---|---|
| Synonyms | 4,4-Diketo-3,3-Dimethyl-4$L^{6}-Thia-1-Azabicyclo[3.2.0]Heptan-7-One; 2,2-Dimethylpenam Sulfone |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.23 |
| CAS Registry Number | 98316-95-1 |
| SMILES | CC2(CN1C(CC1[S]2(=O)=O)=O)C |
| InChI | 1S/C7H11NO3S/c1-7(2)4-8-5(9)3-6(8)12(7,10)11/h6H,3-4H2,1-2H3 |
| InChIKey | INYXNIQRGOOOOQ-UHFFFAOYSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.181°C at 760 mmHg (Cal.) |
| Flash point | 209.732°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethylpenam Sulfone |