|
CAS#: 984-82-7 Product: Solacongestidine No suppilers available for the product. |
| Name | Solacongestidine |
|---|---|
| Synonyms | (3Beta,5Alpha,25Beta)-16,28-Secosolanid-22(28)-En-3-Ol; 16,28-Secosolanid-22(28)-En-3-Ol, (3Beta,5Alpha,25Beta)-; Nci60_041933 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 |
| CAS Registry Number | 984-82-7 |
| SMILES | [C@]24([C@H]([C@@H]1CC[C@@H]3[C@@]([C@H]1CC2)(CC[C@H](O)C3)C)CC[C@@H]4[C@@H](C5=NC[C@@H](CC5)C)C)C |
| InChI | 1S/C27H45NO/c1-17-5-10-25(28-16-17)18(2)22-8-9-23-21-7-6-19-15-20(29)11-13-26(19,3)24(21)12-14-27(22,23)4/h17-24,29H,5-16H2,1-4H3/t17-,18+,19+,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | MSKAAWFUKWQOQS-YNAJWQGRSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.969°C at 760 mmHg (Cal.) |
| Flash point | 334.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Solacongestidine |