|
CAS#: 98410-36-7 Product: Palatrigine No suppilers available for the product. |
| Name | Palatrigine |
|---|---|
| Synonyms | 6-(2,3-Dichlorophenyl)-3-Imino-2-Isopropyl-1,2,4-Triazin-5-Amine; [6-(2,3-Dichlorophenyl)-3-Imino-2-Isopropyl-1,2,4-Triazin-5-Yl]Amine; Bw A256c |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13Cl2N5 |
| Molecular Weight | 298.17 |
| CAS Registry Number | 98410-36-7 |
| SMILES | C2=C(C1=NN(C(=N)N=C1N)C(C)C)C(=C(C=C2)Cl)Cl |
| InChI | 1S/C12H13Cl2N5/c1-6(2)19-12(16)17-11(15)10(18-19)7-4-3-5-8(13)9(7)14/h3-6H,1-2H3,(H3,15,16,17) |
| InChIKey | XJQJAFGEQVKYNF-UHFFFAOYSA-N |
| Density | 1.495g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.102°C at 760 mmHg (Cal.) |
| Flash point | 196.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Palatrigine |