|
CAS#: 98510-76-0 Product: 3-[4-Hydroxy(2-Methylpropoxy)Phenyl]Acrylic Acid No suppilers available for the product. |
| Name | 3-[4-Hydroxy(2-Methylpropoxy)Phenyl]Acrylic Acid |
|---|---|
| Synonyms | (E)-3-(4-Hydroxy-2-Isobutoxy-Phenyl)Prop-2-Enoic Acid; (E)-3-(4-Hydroxy-2-Isobutoxyphenyl)Prop-2-Enoic Acid; (E)-3-(4-Hydroxy-2-Isobutoxy-Phenyl)Acrylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 98510-76-0 |
| EINECS | 308-784-9 |
| SMILES | C1=C(O)C=CC(=C1OCC(C)C)/C=C/C(=O)O |
| InChI | 1S/C13H16O4/c1-9(2)8-17-12-7-11(14)5-3-10(12)4-6-13(15)16/h3-7,9,14H,8H2,1-2H3,(H,15,16)/b6-4+ |
| InChIKey | DGVPVSAARCIEIL-GQCTYLIASA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.389°C at 760 mmHg (Cal.) |
| Flash point | 156.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[4-Hydroxy(2-Methylpropoxy)Phenyl]Acrylic Acid |