|
CAS#: 986-02-7 Product: 3,19-Dioxoandrost-4-en-17-yl benzoate No suppilers available for the product. |
| Name | 3,19-Dioxoandrost-4-en-17-yl benzoate |
|---|---|
| Synonyms | 10-formyl |
| Molecular Structure | ![]() |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.51 |
| CAS Registry Number | 986-02-7 |
| SMILES | O=CC51/C(=C\C(=O)CC1)CCC4C5CCC3(C4CCC3OC(=O)c2ccccc2)C |
| InChI | 1S/C26H30O4/c1-25-13-12-22-20(8-7-18-15-19(28)11-14-26(18,22)16-27)21(25)9-10-23(25)30-24(29)17-5-3-2-4-6-17/h2-6,15-16,20-23H,7-14H2,1H3 |
| InChIKey | FIWQIMWULLZMPF-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.519°C at 760 mmHg (Cal.) |
| Flash point | 239.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,19-Dioxoandrost-4-en-17-yl benzoate |