|
CAS#: 98690-35-8 Product: Ammonium (1,3,5,7,9,11,13,15-Octamethylhexadecyl)Benzenesulphonate No suppilers available for the product. |
| Name | Ammonium (1,3,5,7,9,11,13,15-Octamethylhexadecyl)Benzenesulphonate |
|---|---|
| Synonyms | Ammonium 2-(1,3,5,7,9,11,13,15-Octamethylhexadecyl)Benzenesulfonate; Ammonium (1,3,5,7,9,11,13,15-Octamethylhexadecyl)Benzenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C30H57NO3S |
| Molecular Weight | 511.85 |
| CAS Registry Number | 98690-35-8 |
| EINECS | 308-868-5 |
| SMILES | C1=C(C(CC(CC(CC(CC(CC(CC(CC(C)C)C)C)C)C)C)C)C)C(=CC=C1)[S]([O-])(=O)=O.[NH4+] |
| InChI | 1S/C30H54O3S.H3N/c1-21(2)14-22(3)15-23(4)16-24(5)17-25(6)18-26(7)19-27(8)20-28(9)29-12-10-11-13-30(29)34(31,32)33;/h10-13,21-28H,14-20H2,1-9H3,(H,31,32,33);1H3 |
| InChIKey | KSMFOTKAFZGMFX-UHFFFAOYSA-N |
| Boiling point | 607°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 320.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium (1,3,5,7,9,11,13,15-Octamethylhexadecyl)Benzenesulphonate |