|
CAS#: 98834-95-8 Product: Ethyl (2E,4E,6E)-9-formyl-10-oxo-2,4,6,8-decatetraenoate No suppilers available for the product. |
| Name | Ethyl (2E,4E,6E)-9-formyl-10-oxo-2,4,6,8-decatetraenoate |
|---|---|
| Synonyms | Ethyl (2E,4E,6E)-9-formyl-10-oxo-2,4,6,8-decatetraenoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 |
| CAS Registry Number | 98834-95-8 |
| SMILES | O=C/C(C=O)=C\C=C\C=C\C=C\C(=O)OCC |
| InChI | 1S/C13H14O4/c1-2-17-13(16)9-7-5-3-4-6-8-12(10-14)11-15/h3-11H,2H2,1H3/b5-3+,6-4+,9-7+ |
| InChIKey | ZFNKBXGUVGVLSA-GJOOXVBWSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.169°C at 760 mmHg (Cal.) |
| Flash point | 195.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2E,4E,6E)-9-formyl-10-oxo-2,4,6,8-decatetraenoate |