|
CAS#: 98849-70-8 Product: 2-Nitro-5-(6-Bromohexanoylamino)Benzoic Acid No suppilers available for the product. |
| Name | 2-Nitro-5-(6-Bromohexanoylamino)Benzoic Acid |
|---|---|
| Synonyms | 5-(6-Bromohexanoylamino)-2-Nitro-Benzoic Acid; 5-[(6-Bromo-1-Oxohexyl)Amino]-2-Nitrobenzoic Acid; 2-Nbhba |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 |
| CAS Registry Number | 98849-70-8 |
| SMILES | C1=C(NC(=O)CCCCCBr)C=CC(=C1C(=O)O)[N+]([O-])=O |
| InChI | 1S/C13H15BrN2O5/c14-7-3-1-2-4-12(17)15-9-5-6-11(16(20)21)10(8-9)13(18)19/h5-6,8H,1-4,7H2,(H,15,17)(H,18,19) |
| InChIKey | XTBKPURWMIKVPT-UHFFFAOYSA-N |
| Density | 1.589g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.368°C at 760 mmHg (Cal.) |
| Flash point | 308.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-5-(6-Bromohexanoylamino)Benzoic Acid |