|
CAS#: 98948-82-4 Product: 4,6-Dihydroxy-5,8-dioxo-5,8-dihydro-2-quinolinecarboxylic acid No suppilers available for the product. |
| Name | 4,6-Dihydroxy-5,8-dioxo-5,8-dihydro-2-quinolinecarboxylic acid |
|---|---|
| Synonyms | 4,6-dihyd |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5NO6 |
| Molecular Weight | 235.15 |
| CAS Registry Number | 98948-82-4 |
| SMILES | OC(=O)c1cc(O)c2C(=O)C(\O)=C/C(=O)c2n1 |
| InChI | 1S/C10H5NO6/c12-4-1-3(10(16)17)11-8-5(13)2-6(14)9(15)7(4)8/h1-2,14H,(H,11,12)(H,16,17) |
| InChIKey | STDAOZXVODUFIH-UHFFFAOYSA-N |
| Density | 1.932g/cm3 (Cal.) |
|---|---|
| Boiling point | 826.579°C at 760 mmHg (Cal.) |
| Flash point | 453.699°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dihydroxy-5,8-dioxo-5,8-dihydro-2-quinolinecarboxylic acid |