|
CAS#: 99112-26-2 Product: (E,6E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enylidene)Hept-2-En-1-Ol No suppilers available for the product. |
| Name | (E,6E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enylidene)Hept-2-En-1-Ol |
|---|---|
| Synonyms | 12-Hydroxy-E-Gamma-Bisabolene; 12-Oh-Egb; 2-Hepten-1-Ol, 2-Methyl-6-(4-Methyl-3-Cyclohexen-1-Ylidene)-, (E,E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 99112-26-2 |
| SMILES | C(/C(=C1/CC=C(CC1)C)C)C\C=C(\CO)C |
| InChI | 1S/C15H24O/c1-12-7-9-15(10-8-12)14(3)6-4-5-13(2)11-16/h5,7,16H,4,6,8-11H2,1-3H3/b13-5+,15-14- |
| InChIKey | ZLZBWUVBBIRCMD-OHNCSJITSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.762°C at 760 mmHg (Cal.) |
| Flash point | 125.28°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E,6E)-2-Methyl-6-(4-Methyl-1-Cyclohex-3-Enylidene)Hept-2-En-1-Ol |