|
CAS#: 99112-29-5 Product: (1alpha,5beta,10xi,17beta)-17-Acetoxy-17-ethynylestr-2-en-1-yl 3-cyclopentylpropanoate No suppilers available for the product. |
| Name | (1alpha,5beta,10xi,17beta)-17-Acetoxy-17-ethynylestr-2-en-1-yl 3-cyclopentylpropanoate |
|---|---|
| Synonyms | Neacpp; Norethisterone acetate 3-cyclopentylpropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.65 |
| CAS Registry Number | 99112-29-5 |
| SMILES | O=C(O[C@H]2\C=C/C[C@H]1CC[C@@H]3[C@@H](C12)CC[C@]4([C@H]3CC[C@]4(C#C)OC(=O)C)C)CCC5CCCC5 |
| InChI | 1S/C30H42O4/c1-4-30(34-20(2)31)19-17-25-23-14-13-22-10-7-11-26(28(22)24(23)16-18-29(25,30)3)33-27(32)15-12-21-8-5-6-9-21/h1,7,11,21-26,28H,5-6,8-10,12-19H2,2-3H3/t22-,23+,24-,25-,26-,28?,29-,30-/m0/s1 |
| InChIKey | UKRBBAYWDWAZQF-RYSPWXMHSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.224°C at 760 mmHg (Cal.) |
| Flash point | 257.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1alpha,5beta,10xi,17beta)-17-Acetoxy-17-ethynylestr-2-en-1-yl 3-cyclopentylpropanoate |