|
CAS#: 99152-14-4 Product: [4aS,(+)]-1,2,3,4,5,10,11,11aalpha-Octahydro-1,1-Dimethyl-8-(1-Methylethyl)-4aH-Dibenzo[a,d]Cycloheptene-4abeta,7-Diol No suppilers available for the product. |
| Name | [4aS,(+)]-1,2,3,4,5,10,11,11aalpha-Octahydro-1,1-Dimethyl-8-(1-Methylethyl)-4aH-Dibenzo[a,d]Cycloheptene-4abeta,7-Diol |
|---|---|
| Synonyms | From The Seeds Of Chamaecyparis Pisifera; Nsc608490; Pisiferanol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 |
| CAS Registry Number | 99152-14-4 |
| SMILES | [C@]13(O)C(CCC2=C(C1)C=C(O)C(=C2)C(C)C)C(CCC3)(C)C |
| InChI | 1S/C20H30O2/c1-13(2)16-10-14-6-7-18-19(3,4)8-5-9-20(18,22)12-15(14)11-17(16)21/h10-11,13,18,21-22H,5-9,12H2,1-4H3/t18?,20-/m0/s1 |
| InChIKey | UZNOTFOFROXACM-IJHRGXPZSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.827°C at 760 mmHg (Cal.) |
| Flash point | 197.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4aS,(+)]-1,2,3,4,5,10,11,11aalpha-Octahydro-1,1-Dimethyl-8-(1-Methylethyl)-4aH-Dibenzo[a,d]Cycloheptene-4abeta,7-Diol |