|
CAS#: 99217-68-2 Product: Broussochalcone A No suppilers available for the product. |
| Name | Broussochalcone A |
|---|---|
| Synonyms | 2-Propen-1-One, 1-(2,4-Dihydroxy-5-(3-Methyl-2-Butenyl)Phenyl)-3-(3,4-Dihydroxyphenyl)-, (E)-; Broussochalcone A |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 |
| CAS Registry Number | 99217-68-2 |
| SMILES | C1=C(C(=CC(=C1CC=C(C)C)O)O)C(/C=C/C2=CC=C(O)C(=C2)O)=O |
| InChI | 1S/C20H20O5/c1-12(2)3-6-14-10-15(19(24)11-18(14)23)16(21)7-4-13-5-8-17(22)20(25)9-13/h3-5,7-11,22-25H,6H2,1-2H3/b7-4+ |
| InChIKey | FEALTYYKRMRXTG-QPJJXVBHSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.011°C at 760 mmHg (Cal.) |
| Flash point | 327.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Broussochalcone A |