|
CAS#: 99281-07-9 Product: Sodium 4-formylphenyl methyl phosphate No suppilers available for the product. |
| Name | Sodium 4-formylphenyl methyl phosphate |
|---|---|
| Synonyms | MFPP; Phosphori |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8NaO5P |
| Molecular Weight | 238.11 |
| CAS Registry Number | 99281-07-9 |
| SMILES | [Na+].[O-]P(=O)(OC)Oc1ccc(cc1)C=O |
| InChI | 1S/C8H9O5P.Na/c1-12-14(10,11)13-8-4-2-7(6-9)3-5-8;/h2-6H,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | AVSXBVJTAQAXLS-UHFFFAOYSA-M |
| Boiling point | 358.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 170.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 4-formylphenyl methyl phosphate |